ChemNet > CAS > 1722-10-7 3-Chloro-6-methoxypyridazine
1722-10-7 3-Chloro-6-methoxypyridazine
Naam product |
3-Chloro-6-methoxypyridazine |
MF |
C5H5ClN2O |
Molecuulgewicht |
144.559 |
InChI |
InChI=1/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
CAS-nummer |
1722-10-7 |
EINECS |
217-019-7 |
Moleculaire Structuur |
|
Dichtheid |
1.292g/cm3 |
Smeltpunt |
85-92℃ |
Kookpunt |
284.9°C at 760 mmHg |
Brekingsindex |
1.52 |
Vlampunt |
126.1°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|