ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
Naam product |
2,3-Dichlorothiophene |
Synoniemen |
2,3-dichloro-thiophene |
MF |
C4H2Cl2S |
Molecuulgewicht |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS-nummer |
17249-79-5;17249-29-5 |
Moleculaire Structuur |
|
Dichtheid |
1.488g/cm3 |
Smeltpunt |
-26℃ |
Kookpunt |
170.7°C at 760 mmHg |
Brekingsindex |
1.584 |
Vlampunt |
68.9°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|