ChemNet > CAS > 175135-11-2 4-Cyclohexyl-2,6-dibromoaniline
175135-11-2 4-Cyclohexyl-2,6-dibromoaniline
Naam product |
4-Cyclohexyl-2,6-dibromoaniline |
Synoniemen |
2,6-Dibromo-4-cyclohexylaniline |
MF |
C12H15Br2N |
Molecuulgewicht |
333.0622 |
InChI |
InChI=1/C12H15Br2N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8H,1-5,15H2 |
CAS-nummer |
175135-11-2 |
Moleculaire Structuur |
|
Dichtheid |
1.622g/cm3 |
Smeltpunt |
37℃ |
Kookpunt |
361.7°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
172.5°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|