ChemNet > CAS > 175135-93-0 2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one
175135-93-0 2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one
Naam product |
2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one |
MF |
C10H10BrClO |
Molecuulgewicht |
261.5428 |
InChI |
InChI=1/C10H10BrClO/c1-6-3-4-8(5-9(6)12)10(13)7(2)11/h3-5,7H,1-2H3 |
CAS-nummer |
175135-93-0 |
Moleculaire Structuur |
|
Dichtheid |
1.459g/cm3 |
Kookpunt |
317.5°C at 760 mmHg |
Brekingsindex |
1.564 |
Vlampunt |
145.8°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|