ChemNet > CAS > 175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
Naam product |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
Synoniemen |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
MF |
C11H8ClFN2OS |
Molecuulgewicht |
270.7104 |
InChI |
InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
CAS-nummer |
175204-41-8 |
Moleculaire Structuur |
|
Dichtheid |
1.426g/cm3 |
Smeltpunt |
85℃ |
Kookpunt |
408.4°C at 760 mmHg |
Brekingsindex |
1.625 |
Vlampunt |
200.8°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|