ChemNet > CAS > 175205-18-2 N-(4-propylphenyl)thiourea
175205-18-2 N-(4-propylphenyl)thiourea
Naam product |
N-(4-propylphenyl)thiourea |
Synoniemen |
1-(4-propylphenyl)thiourea |
MF |
C10H14N2S |
Molecuulgewicht |
194.2966 |
InChI |
InChI=1/C10H14N2S/c1-2-3-8-4-6-9(7-5-8)12-10(11)13/h4-7H,2-3H2,1H3,(H3,11,12,13) |
CAS-nummer |
175205-18-2 |
Moleculaire Structuur |
|
Dichtheid |
1.164g/cm3 |
Smeltpunt |
165℃ |
Kookpunt |
310°C at 760 mmHg |
Brekingsindex |
1.65 |
Vlampunt |
141.3°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S37/39:Wear suitable gloves and eye/face protection.;
|
|