ChemNet > CAS > 175277-93-7 2-Amino-6-fluorobenzylamine
175277-93-7 2-Amino-6-fluorobenzylamine
Naam product |
2-Amino-6-fluorobenzylamine |
Synoniemen |
2-(Aminomethyl)-3-fluoroaniline |
MF |
C7H9FN2 |
Molecuulgewicht |
140.1582 |
InChI |
InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
CAS-nummer |
175277-93-7 |
Moleculaire Structuur |
|
Dichtheid |
1.209g/cm3 |
Kookpunt |
265°C at 760 mmHg |
Brekingsindex |
1.586 |
Vlampunt |
117.4°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|