ChemNet > CAS > 175278-28-1 5-Fluoro-2-methylbenzamide
175278-28-1 5-Fluoro-2-methylbenzamide
Naam product |
5-Fluoro-2-methylbenzamide |
MF |
C8H8FNO |
Molecuulgewicht |
153.1536 |
InChI |
InChI=1/C8H8FNO/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H2,10,11) |
CAS-nummer |
175278-28-1 |
Moleculaire Structuur |
|
Dichtheid |
1.19g/cm3 |
Smeltpunt |
120℃ |
Kookpunt |
214.6°C at 760 mmHg |
Brekingsindex |
1.534 |
Vlampunt |
83.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|