ChemNet > CAS > 18355-75-4 2,3-difluorobenzamide
18355-75-4 2,3-difluorobenzamide
Naam product |
2,3-difluorobenzamide |
Synoniemen |
2,3-Difluorobenzamide |
MF |
C7H5F2NO |
Molecuulgewicht |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
CAS-nummer |
18355-75-4 |
Moleculaire Structuur |
|
Dichtheid |
1.348g/cm3 |
Kookpunt |
197°C at 760 mmHg |
Brekingsindex |
1.515 |
Vlampunt |
73°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|