ChemNet > CAS > 18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
Naam product |
1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene |
Synoniemen |
1-(3,5-Dimethoxyphenyl)-2-nitroprop-1-ene; 1,3-dimethoxy-5-(2-nitroprop-1-en-1-yl)benzene |
MF |
C11H13NO4 |
Molecuulgewicht |
223.2252 |
InChI |
InChI=1/C11H13NO4/c1-8(12(13)14)4-9-5-10(15-2)7-11(6-9)16-3/h4-7H,1-3H3 |
CAS-nummer |
18917-76-5 |
Moleculaire Structuur |
|
Dichtheid |
1.168g/cm3 |
Smeltpunt |
87℃ |
Kookpunt |
358°C at 760 mmHg |
Brekingsindex |
1.555 |
Vlampunt |
159.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|