ChemNet > CAS > 190011-87-1 3-Chloro-2,6-difluorobenzaldehyde
190011-87-1 3-Chloro-2,6-difluorobenzaldehyde
| Naam product |
3-Chloro-2,6-difluorobenzaldehyde |
| MF |
C7H3ClF2O |
| Molecuulgewicht |
176.5479 |
| InChI |
InChI=1/C7H3ClF2O/c8-5-1-2-6(9)4(3-11)7(5)10/h1-3H |
| CAS-nummer |
190011-87-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.453g/cm3 |
| Smeltpunt |
46-49℃ |
| Kookpunt |
207.8°C at 760 mmHg |
| Brekingsindex |
1.536 |
| Vlampunt |
79.5°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
