ChemNet > CAS > 191-07-1 Coronene
191-07-1 Coronene
Naam product |
Coronene |
Synoniemen |
Hexabenzobenzene; Coronene (purity) |
MF |
C24H12 |
Molecuulgewicht |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
CAS-nummer |
191-07-1 |
EINECS |
205-881-7 |
Moleculaire Structuur |
|
Dichtheid |
1.467g/cm3 |
Smeltpunt |
438-440℃ |
Kookpunt |
525.6°C at 760 mmHg |
Brekingsindex |
2.139 |
Vlampunt |
265.2°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|