ChemNet > CAS > 2005-08-5 4-chlorophenyl benzoate
2005-08-5 4-chlorophenyl benzoate
Naam product |
4-chlorophenyl benzoate |
Synoniemen |
4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
MF |
C13H9ClO2 |
Molecuulgewicht |
232.6624 |
InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
CAS-nummer |
2005-08-5 |
EINECS |
217-910-0 |
Moleculaire Structuur |
|
Dichtheid |
1.258g/cm3 |
Smeltpunt |
87-89℃ |
Kookpunt |
343.1°C at 760 mmHg |
Brekingsindex |
1.594 |
Vlampunt |
175.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|