ChemNet > CAS > 20256-39-7 2-Acetamido-5-chlorothiazole
20256-39-7 2-Acetamido-5-chlorothiazole
Naam product |
2-Acetamido-5-chlorothiazole |
Synoniemen |
N-(5-chloro-1,3-thiazol-2-yl)acetamide |
MF |
C5H5ClN2OS |
Molecuulgewicht |
176.624 |
InChI |
InChI=1/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9) |
CAS-nummer |
20256-39-7 |
Moleculaire Structuur |
|
Dichtheid |
1.507g/cm3 |
Brekingsindex |
1.633 |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|