ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
Naam product |
2-Bromo-4-fluoro-1-iodobenzene |
Synoniemen |
2-Bromo-4-fluoroiodobenzene |
MF |
C6H3BrFI |
Molecuulgewicht |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
CAS-nummer |
202865-73-4 |
Moleculaire Structuur |
|
Dichtheid |
2.281g/cm3 |
Kookpunt |
243.2°C at 760 mmHg |
Brekingsindex |
1.628 |
Vlampunt |
100.9°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|