ChemNet > CAS > 20469-63-0 Dimethoxyiodobenzene
20469-63-0 Dimethoxyiodobenzene
Naam product |
Dimethoxyiodobenzene |
Synoniemen |
1,3-Dimethoxy-4-iodobenzene; 1-Iodo-2,4-dimethoxybenzene; Benzene, 1-iodo-2,4-dimethoxy-; 2,4-Dimethoxyiodobenzene |
MF |
C8H9IO2 |
Molecuulgewicht |
264.0603 |
InChI |
InChI=1/C8H9IO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
CAS-nummer |
20469-63-0 |
Moleculaire Structuur |
|
Dichtheid |
1.655g/cm3 |
Smeltpunt |
37-41℃ |
Kookpunt |
284.3°C at 760 mmHg |
Brekingsindex |
1.572 |
Vlampunt |
125.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|