ChemNet > CAS > 2049-73-2 1,3-Diethoxybenzene
2049-73-2 1,3-Diethoxybenzene
Naam product |
1,3-Diethoxybenzene |
Synoniemen |
1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
MF |
C10H14O2 |
Molecuulgewicht |
166.217 |
InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
CAS-nummer |
2049-73-2 |
EINECS |
218-071-3 |
Moleculaire Structuur |
|
Dichtheid |
0.975g/cm3 |
Smeltpunt |
10-236℃ |
Kookpunt |
238.5°C at 760 mmHg |
Brekingsindex |
1.485 |
Vlampunt |
87.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|