ChemNet > CAS > 206559-57-1 2,5-difluorophenyl isothiocyanate
206559-57-1 2,5-difluorophenyl isothiocyanate
| Naam product |
2,5-difluorophenyl isothiocyanate |
| Synoniemen |
1,4-difluoro-2-isocyanatobenzene |
| MF |
C7H3F2NO |
| Molecuulgewicht |
155.1016 |
| InChI |
InChI=1/C7H3F2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| CAS-nummer |
206559-57-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.24g/cm3 |
| Kookpunt |
181.1°C at 760 mmHg |
| Brekingsindex |
1.488 |
| Vlampunt |
56.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
