ChemNet > CAS > 207919-09-3 2,3,4-trifluorobenzamide
207919-09-3 2,3,4-trifluorobenzamide
Naam product |
2,3,4-trifluorobenzamide |
Synoniemen |
Trifluorobenzamide1 |
MF |
C7H4F3NO |
Molecuulgewicht |
175.108 |
InChI |
InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
CAS-nummer |
207919-09-3 |
Moleculaire Structuur |
|
Dichtheid |
1.45g/cm3 |
Smeltpunt |
127-129℃ |
Kookpunt |
166°C at 760 mmHg |
Brekingsindex |
1.494 |
Vlampunt |
54.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|