ChemNet > CAS > 208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
Naam product |
5-Chloro-1,2-dibromo-3-fluorobenzene |
Synoniemen |
5-Chloro-2,3-dibromo-1-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene |
MF |
C6H2Br2ClF |
Molecuulgewicht |
288.3395 |
InChI |
InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
CAS-nummer |
208186-78-1 |
Moleculaire Structuur |
|
Dichtheid |
2.089g/cm3 |
Kookpunt |
245.3°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
102.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|