ChemNet > CAS > 2107-77-9 7,8-Dihydroxy-4-methylcoumarin
2107-77-9 7,8-Dihydroxy-4-methylcoumarin
Naam product |
7,8-Dihydroxy-4-methylcoumarin |
Synoniemen |
4-Methyldaphnetin; 7,8-dihydroxy-4-methyl-2H-chromen-2-one |
MF |
C10H8O4 |
Molecuulgewicht |
192.1681 |
InChI |
InChI=1/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
CAS-nummer |
2107-77-9 |
EINECS |
218-290-4 |
Moleculaire Structuur |
|
Dichtheid |
1.456g/cm3 |
Kookpunt |
421.5°C at 760 mmHg |
Brekingsindex |
1.651 |
Vlampunt |
176°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|