ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
Naam product |
3-Nitrobiphenyl |
Synoniemen |
3-Nitrodiphenyl |
MF |
C12H9NO2 |
Molecuulgewicht |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
CAS-nummer |
2113-58-8 |
EINECS |
218-305-4 |
Moleculaire Structuur |
|
Dichtheid |
1.196g/cm3 |
Smeltpunt |
56-60℃ |
Kookpunt |
339°C at 760 mmHg |
Brekingsindex |
1.605 |
Vlampunt |
161.4°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R40:Possible risks of irreversible effects.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|