ChemNet > CAS > 212779-19-6 2,3,5-Trichlorobenzeneboronic acid
212779-19-6 2,3,5-Trichlorobenzeneboronic acid
Naam product |
2,3,5-Trichlorobenzeneboronic acid |
Synoniemen |
Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
MF |
C6H4BCl3O2 |
Molecuulgewicht |
225.2648 |
InChI |
InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
CAS-nummer |
212779-19-6 |
Moleculaire Structuur |
|
Dichtheid |
1.6g/cm3 |
Kookpunt |
383.4°C at 760 mmHg |
Brekingsindex |
1.594 |
Vlampunt |
185.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|