ChemNet > CAS > 21557-09-5 4-(1-Pyrrolidino)acetophenone
21557-09-5 4-(1-Pyrrolidino)acetophenone
Naam product |
4-(1-Pyrrolidino)acetophenone |
Synoniemen |
1-[4-(pyrrolidin-1-yl)phenyl]ethanone |
MF |
C12H15NO |
Molecuulgewicht |
189.2536 |
InChI |
InChI=1/C12H15NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS-nummer |
21557-09-5 |
Moleculaire Structuur |
|
Dichtheid |
1.078g/cm3 |
Kookpunt |
342.7°C at 760 mmHg |
Brekingsindex |
1.556 |
Vlampunt |
136.5°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|