ChemNet > CAS > 2199-93-1 3-Acetyl-6-bromocoumarin
2199-93-1 3-Acetyl-6-bromocoumarin
Naam product |
3-Acetyl-6-bromocoumarin |
Synoniemen |
3-acetyl-6-bromo-2H-chromen-2-one |
MF |
C11H7BrO3 |
Molecuulgewicht |
267.0755 |
InChI |
InChI=1/C11H7BrO3/c1-6(13)9-5-7-4-8(12)2-3-10(7)15-11(9)14/h2-5H,1H3 |
CAS-nummer |
2199-93-1 |
Moleculaire Structuur |
|
Dichtheid |
1.643g/cm3 |
Kookpunt |
441.3°C at 760 mmHg |
Brekingsindex |
1.614 |
Vlampunt |
220.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|