ChemNet > CAS > 22034-13-5 4-bromo-2,1,3-benzothiadiazole
22034-13-5 4-bromo-2,1,3-benzothiadiazole
Naam product |
4-bromo-2,1,3-benzothiadiazole |
MF |
C6H3BrN2S |
Molecuulgewicht |
215.0704 |
InChI |
InChI=1/C6H3BrN2S/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H |
CAS-nummer |
22034-13-5 |
Moleculaire Structuur |
|
Dichtheid |
1.859g/cm3 |
Smeltpunt |
83℃ |
Kookpunt |
272.2°C at 760 mmHg |
Brekingsindex |
1.733 |
Vlampunt |
118.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|