ChemNet > CAS > 22711-24-6 1-(4-nitrophenyl)-2-phenylethane-1,2-dione
22711-24-6 1-(4-nitrophenyl)-2-phenylethane-1,2-dione
Naam product |
1-(4-nitrophenyl)-2-phenylethane-1,2-dione |
MF |
C14H9NO4 |
Molecuulgewicht |
255.2256 |
InChI |
InChI=1/C14H9NO4/c16-13(10-4-2-1-3-5-10)14(17)11-6-8-12(9-7-11)15(18)19/h1-9H |
CAS-nummer |
22711-24-6 |
Moleculaire Structuur |
|
Dichtheid |
1.327g/cm3 |
Smeltpunt |
130℃ |
Kookpunt |
444.9°C at 760 mmHg |
Brekingsindex |
1.623 |
Vlampunt |
220.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|