ChemNet > CAS > 22884-95-3 3,4-Dimethylbenzonitrile
22884-95-3 3,4-Dimethylbenzonitrile
Naam product |
3,4-Dimethylbenzonitrile |
Synoniemen |
Benzonitrile, 3,4-dimethyl-; 0-09-00-00536 (Beilstein Handbook Reference); BRN 0970523 |
MF |
C9H9N |
Molecuulgewicht |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,1-2H3 |
CAS-nummer |
22884-95-3 |
EINECS |
245-293-8 |
Moleculaire Structuur |
|
Dichtheid |
0.99g/cm3 |
Smeltpunt |
64-66℃ |
Kookpunt |
253.5°C at 760 mmHg |
Brekingsindex |
1.525 |
Vlampunt |
107.1°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|