ChemNet > CAS > 22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
Naam product |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
Synoniemen |
ethyl 2-bromo-4-methylthiazole-5-carboxylate |
MF |
C7H8BrNO2S |
Molecuulgewicht |
250.1129 |
InChI |
InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
CAS-nummer |
22900-83-0 |
Moleculaire Structuur |
|
Dichtheid |
1.573g/cm3 |
Smeltpunt |
68℃ |
Kookpunt |
287.086°C at 760 mmHg |
Brekingsindex |
1.563 |
Vlampunt |
127.426°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|