ChemNet > CAS > 23132-21-0 2-Bromo-3-methyl-5-nitropyridine
23132-21-0 2-Bromo-3-methyl-5-nitropyridine
Naam product |
2-Bromo-3-methyl-5-nitropyridine |
Synoniemen |
2-Bromo-5-nitro-3-picoline |
MF |
C6H5BrN2O2 |
Molecuulgewicht |
217.0201 |
InChI |
InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
CAS-nummer |
23132-21-0 |
Moleculaire Structuur |
|
Dichtheid |
1.709g/cm3 |
Kookpunt |
305.1°C at 760 mmHg |
Brekingsindex |
1.599 |
Vlampunt |
138.3°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|