ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
Naam product |
3-Bromo-4-hydroxybenzonitrile |
Synoniemen |
2-Bromo-4-cyanophenol |
MF |
C7H4BrNO |
Molecuulgewicht |
198.0168 |
InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
CAS-nummer |
2315-86-8 |
EINECS |
219-022-9 |
Moleculaire Structuur |
|
Dichtheid |
1.79g/cm3 |
Smeltpunt |
155℃ |
Kookpunt |
271.1°C at 760 mmHg |
Brekingsindex |
1.656 |
Vlampunt |
117.8°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|