ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
Naam product |
3,4-difluoropropiophenone |
Synoniemen |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
MF |
C9H8F2O |
Molecuulgewicht |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
CAS-nummer |
23384-72-7 |
EINECS |
245-627-2 |
Moleculaire Structuur |
|
Dichtheid |
1.166g/cm3 |
Kookpunt |
225°C at 760 mmHg |
Brekingsindex |
1.472 |
Vlampunt |
84.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|