ChemNet > CAS > 2350-89-2 4-Vinylbiphenyl
2350-89-2 4-Vinylbiphenyl
Naam product |
4-Vinylbiphenyl |
Synoniemen |
4-Phenylstyrene; 4-ethenylbiphenyl |
MF |
C14H12 |
Molecuulgewicht |
180.2451 |
InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
CAS-nummer |
2350-89-2 |
EINECS |
219-082-6 |
Moleculaire Structuur |
|
Dichtheid |
0.997g/cm3 |
Smeltpunt |
115-121℃ |
Kookpunt |
301.7°C at 760 mmHg |
Brekingsindex |
1.599 |
Vlampunt |
139.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|