ChemNet > CAS > 2439-85-2 N-Bromophthalimide
2439-85-2 N-Bromophthalimide
Naam product |
N-Bromophthalimide |
Synoniemen |
AI3-18212; NSC 3525; 1H-Isoindole-1,3(2H)-dione, 2-bromo-; 2-bromo-1H-isoindole-1,3(2H)-dione |
MF |
C8H4BrNO2 |
Molecuulgewicht |
226.0269 |
InChI |
InChI=1/C8H4BrNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
CAS-nummer |
2439-85-2 |
EINECS |
219-467-9 |
Moleculaire Structuur |
|
Dichtheid |
1.932g/cm3 |
Smeltpunt |
199-203℃ |
Kookpunt |
332.3°C at 760 mmHg |
Brekingsindex |
1.704 |
Vlampunt |
154.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|