ChemNet > CAS > 2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
Naam product |
2-Chloro-3,5-dinitrobenzoic acid |
Synoniemen |
2-C-3,5-DNBA; 2-chloro-3,5-dinitrobenzoate |
MF |
C7H2ClN2O6 |
Molecuulgewicht |
245.5541 |
InChI |
InChI=1/C7H3ClN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
CAS-nummer |
2497-91-8 |
EINECS |
219-684-9 |
Moleculaire Structuur |
|
Smeltpunt |
196-199℃ |
Kookpunt |
408.3°C at 760 mmHg |
Vlampunt |
200.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|