ChemNet > CAS > 25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
Naam product |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
Synoniemen |
1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
MF |
C6H8N2O |
Molecuulgewicht |
124.1405 |
InChI |
InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
CAS-nummer |
25016-09-5 |
Moleculaire Structuur |
|
Dichtheid |
1.114g/cm3 |
Smeltpunt |
40℃ |
Kookpunt |
227.739°C at 760 mmHg |
Brekingsindex |
1.543 |
Vlampunt |
91.534°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|