ChemNet > CAS > 2527-99-3 Methyl 5-bromo-2-furoate
2527-99-3 Methyl 5-bromo-2-furoate
Naam product |
Methyl 5-bromo-2-furoate |
Synoniemen |
methyl 5-bromofuran-2-carboxylate |
MF |
C6H5BrO3 |
Molecuulgewicht |
205.0061 |
InChI |
InChI=1/C6H5BrO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
CAS-nummer |
2527-99-3 |
Moleculaire Structuur |
|
Dichtheid |
1.623g/cm3 |
Smeltpunt |
62-65℃ |
Kookpunt |
226.3°C at 760 mmHg |
Brekingsindex |
1.513 |
Vlampunt |
90.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|