ChemNet > CAS > 2563-07-7 2-Ethoxy-p-cresol
2563-07-7 2-Ethoxy-p-cresol
Naam product |
2-Ethoxy-p-cresol |
Synoniemen |
2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
MF |
C9H12O2 |
Molecuulgewicht |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
CAS-nummer |
2563-07-7 |
Moleculaire Structuur |
|
Dichtheid |
1.052g/cm3 |
Kookpunt |
243.7°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
105°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|