ChemNet > CAS > 584-03-2;26171-83-5 1,2-Butanediol
584-03-2;26171-83-5 1,2-Butanediol
Naam product |
1,2-Butanediol |
Synoniemen |
.+/-.-1,2-Butanediol; 1,2-Butanediol, (.+/-.)-; Butane-1,2-diol; Butanediol, 1,2-; 1,2-Dihydroxybutane; 4-01-00-02507 (Beilstein Handbook Reference); AI3-07554; BRN 0969169; HSDB 1507; NSC 24242; alpha-Butylene glycol; alpha-Butyleneglycol; (2S)-butane-1,2-diol |
MF |
C4H10O2 |
Molecuulgewicht |
90.121 |
InChI |
InChI=1/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
CAS-nummer |
584-03-2;26171-83-5 |
EINECS |
209-527-2 |
Moleculaire Structuur |
|
Dichtheid |
1.001g/cm3 |
Smeltpunt |
-50℃ |
Kookpunt |
190.3°C at 760 mmHg |
Brekingsindex |
1.437 |
Vlampunt |
93.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|