ChemNet > CAS > 2628-17-3 4-Vinylphenol
2628-17-3 4-Vinylphenol
| Naam product |
4-Vinylphenol |
| Synoniemen |
4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| MF |
C8H8O |
| Molecuulgewicht |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS-nummer |
2628-17-3 |
| EINECS |
220-103-6 |
| Moleculaire Structuur |
|
| Smeltpunt |
73℃ |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
