ChemNet > CAS > 2628-17-3 4-Vinylphenol
2628-17-3 4-Vinylphenol
Naam product |
4-Vinylphenol |
Synoniemen |
4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
MF |
C8H8O |
Molecuulgewicht |
120.15 |
InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
CAS-nummer |
2628-17-3 |
EINECS |
220-103-6 |
Moleculaire Structuur |
|
Smeltpunt |
73℃ |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|