ChemNet > CAS > 2719-08-6 Methyl 2-acetamidobenzoate
2719-08-6 Methyl 2-acetamidobenzoate
Naam product |
Methyl 2-acetamidobenzoate |
Synoniemen |
methyl 2-(acetylamino)benzoate; Methyl N-acetylanthranilate; ACETYL-N-METHYL-ANTHRANILATE |
MF |
C10H11NO3 |
Molecuulgewicht |
193.1992 |
InChI |
InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
CAS-nummer |
2719-08-6 |
EINECS |
220-318-5 |
Moleculaire Structuur |
|
Dichtheid |
1.204g/cm3 |
Smeltpunt |
97-101℃ |
Kookpunt |
376.3°C at 760 mmHg |
Brekingsindex |
1.565 |
Vlampunt |
181.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|