ChemNet > CAS > 2777-65-3 10-Undecynoic acid
2777-65-3 10-Undecynoic acid
| Naam product |
10-Undecynoic acid |
| MF |
C11H18O2 |
| Molecuulgewicht |
182.2594 |
| InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| CAS-nummer |
2777-65-3 |
| EINECS |
220-471-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.966g/cm3 |
| Kookpunt |
297.7°C at 760 mmHg |
| Brekingsindex |
1.468 |
| Vlampunt |
142.9°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
