ChemNet > CAS > 28439-86-3 4-butoxyphenyl isocyanate
28439-86-3 4-butoxyphenyl isocyanate
| Naam product |
4-butoxyphenyl isocyanate |
| Synoniemen |
4-n-Butoxyphenyl isocyanate; 1-butoxy-4-isocyanatobenzene |
| MF |
C11H13NO2 |
| Molecuulgewicht |
191.2264 |
| InChI |
InChI=1/C11H13NO2/c1-2-3-8-14-11-6-4-10(5-7-11)12-9-13/h4-7H,2-3,8H2,1H3 |
| CAS-nummer |
28439-86-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.01g/cm3 |
| Kookpunt |
274.7°C at 760 mmHg |
| Brekingsindex |
1.503 |
| Vlampunt |
114.4°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
