ChemNet > CAS > 29114-66-7 p-Fluorovalerophenone
29114-66-7 p-Fluorovalerophenone
Naam product |
p-Fluorovalerophenone |
Synoniemen |
4-Fluorovalerophenone; n-Butyl 4-fluorophenyl ketone; 1-(4-fluorophenyl)pentan-1-one; 4'-FLUOROVALEROPHENONE |
MF |
C11H13FO |
Molecuulgewicht |
180.2187 |
InChI |
InChI=1/C11H13FO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
CAS-nummer |
29114-66-7 |
EINECS |
211-907-8 |
Moleculaire Structuur |
|
Dichtheid |
1.031g/cm3 |
Smeltpunt |
23-25℃ |
Kookpunt |
253.1°C at 760 mmHg |
Brekingsindex |
1.486 |
Vlampunt |
100.2°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|