ChemNet > CAS > 30544-34-4 2,3-Dibromofuran
30544-34-4 2,3-Dibromofuran
Naam product |
2,3-Dibromofuran |
MF |
C4H2Br2O |
Molecuulgewicht |
225.8661 |
InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
CAS-nummer |
30544-34-4 |
Moleculaire Structuur |
|
Dichtheid |
2.159g/cm3 |
Kookpunt |
175.6°C at 760 mmHg |
Brekingsindex |
1.562 |
Vlampunt |
60°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|