ChemNet > CAS > 306935-55-7 4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine
306935-55-7 4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine
Naam product |
4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine |
Synoniemen |
4,5-dichloro-6-methyl-2-pyridin-2-ylpyrimidine |
MF |
C10H7Cl2N3 |
Molecuulgewicht |
240.0887 |
InChI |
InChI=1/C10H7Cl2N3/c1-6-8(11)9(12)15-10(14-6)7-4-2-3-5-13-7/h2-5H,1H3 |
CAS-nummer |
306935-55-7 |
Moleculaire Structuur |
|
Dichtheid |
1.375g/cm3 |
Smeltpunt |
132℃ |
Kookpunt |
270.4°C at 760 mmHg |
Brekingsindex |
1.6 |
Vlampunt |
143.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|