ChemNet > CAS > 3156-39-6 beta,2-Dinitrostyrene
3156-39-6 beta,2-Dinitrostyrene
Naam product |
beta,2-Dinitrostyrene |
Synoniemen |
2-Nitro-1-(2-nitrophenyl)ethene~2-Nitro-beta-nitrostyrene; 1-nitro-2-[(E)-2-nitroethenyl]benzene |
MF |
C8H6N2O4 |
Molecuulgewicht |
194.1442 |
InChI |
InChI=1/C8H6N2O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H/b6-5+ |
CAS-nummer |
3156-39-6 |
Moleculaire Structuur |
|
Dichtheid |
1.401g/cm3 |
Kookpunt |
356.6°C at 760 mmHg |
Brekingsindex |
1.642 |
Vlampunt |
183.3°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|