ChemNet > CAS > 3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
3259-03-8 2-(2-Ethoxyphenoxy)ethyl bromide
Naam product |
2-(2-Ethoxyphenoxy)ethyl bromide |
Synoniemen |
2-(2-ethoxyphenoxy)bromide ethane; 5-(2-oxypropyl)-2-methoxybenzene sulphonamide; 1-(2-bromoethoxy)-2-ethoxybenzene; 2-(2-ethoxyphenoxy) bromide ethane |
MF |
C10H13BrO2 |
Molecuulgewicht |
245.113 |
InChI |
InChI=1/C10H13BrO2/c1-2-12-9-5-3-4-6-10(9)13-8-7-11/h3-6H,2,7-8H2,1H3 |
CAS-nummer |
3259-03-8 |
Moleculaire Structuur |
|
Dichtheid |
1.334g/cm3 |
Kookpunt |
286.9°C at 760 mmHg |
Brekingsindex |
1.528 |
Vlampunt |
119.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|