ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
Naam product |
4,5-Dinitro-o-phenylenediamine |
Synoniemen |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
MF |
C6H6N4O4 |
Molecuulgewicht |
198.1362 |
InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
CAS-nummer |
32690-28-1 |
Moleculaire Structuur |
|
Dichtheid |
1.683g/cm3 |
Smeltpunt |
213℃ |
Kookpunt |
541.1°C at 760 mmHg |
Brekingsindex |
1.747 |
Vlampunt |
281°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|