CAS No: 330680-46-1, Chemical Name: Trimethyl 2,2':6',2''-terpyridine-4,4',4''-tricarboxylate
the physical and chemical property of 330680-46-1, Trimethyl 2,2':6',2''-terpyridine-4,4',4''-tricarboxylate is provided by ChemNet.com
ChemNet > CAS > 330680-46-1 Trimethyl 2,2':6',2''-terpyridine-4,4',4''-tricarboxylate
330680-46-1 Trimethyl 2,2':6',2''-terpyridine-4,4',4''-tricarboxylate
Naam product |
Trimethyl 2,2':6',2''-terpyridine-4,4',4''-tricarboxylate |
Synoniemen |
330680-46-1; Trimethyl-2,2':6',2''-terpyridin-4,4',4''-tricarboxylat |
MF |
C21H17N3O6 |
Molecuulgewicht |
407.3762 |
InChI |
InChI=1/C21H17N3O6/c1-28-19(25)12-4-6-22-15(8-12)17-10-14(21(27)30-3)11-18(24-17)16-9-13(5-7-23-16)20(26)29-2/h4-11H,1-3H3 |
CAS-nummer |
330680-46-1 |
Moleculaire Structuur |
|
Dichtheid |
1.3g/cm3 |
Kookpunt |
603.8°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
319°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|